Difference between revisions of "CPD-19172"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15362 == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
(Created page with "Category:metabolite == Metabolite PUTRESCINE == * common-name: ** putrescine * smiles: ** c([n+])ccc[n+] * inchi-key: ** kidhwzjucrjvml-uhfffaoysa-p * molecular-weight: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15362 ==
+
== Metabolite PUTRESCINE ==
 
* common-name:
 
* common-name:
** (2e,11z)-icosa-2,11-dienoyl-coa
+
** putrescine
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c([n+])ccc[n+]
 
* inchi-key:
 
* inchi-key:
** laeceuxzoonxdy-nwgwhigpsa-j
+
** kidhwzjucrjvml-uhfffaoysa-p
 
* molecular-weight:
 
* molecular-weight:
** 1053.99
+
** 90.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ABC-25-RXN]]
 +
* [[APAPT]]
 +
* [[SPERMIDINESYN-RXN]]
 +
* [[TRANS-RXN-69]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14485]]
+
* [[ABC-25-RXN]]
 +
* [[AGMATIN-RXN]]
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 +
* [[ORDC]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[SPERMIDINESYN-RXN]]
 +
* [[TRANS-RXN-69]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
+
{{#set: common-name=putrescine}}
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
+
{{#set: inchi-key=inchikey=kidhwzjucrjvml-uhfffaoysa-p}}
{{#set: molecular-weight=1053.99}}
+
{{#set: molecular-weight=90.168}}

Revision as of 18:59, 14 January 2021

Metabolite PUTRESCINE

  • common-name:
    • putrescine
  • smiles:
    • c([n+])ccc[n+]
  • inchi-key:
    • kidhwzjucrjvml-uhfffaoysa-p
  • molecular-weight:
    • 90.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality