Difference between revisions of "CPD-17046"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-341 == * common-name: ** indole-3-ethanol * smiles: ** c2(=c(cco)c1(c=cc=cc=1n2)) * inchi-key: ** mbbomcvgycrmea-uhfffaoysa-n * molec...") |
(Created page with "Category:metabolite == Metabolite THZ == * common-name: ** 5-(2-hydroxyethyl)-4-methylthiazole * smiles: ** cc1(n=csc(cco)=1) * inchi-key: ** bkawjirckvuved-uhfffaoysa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite THZ == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-(2-hydroxyethyl)-4-methylthiazole |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(n=csc(cco)=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bkawjirckvuved-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 143.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[THIAZOLSYN3-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[THIAMINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-(2-hydroxyethyl)-4-methylthiazole}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bkawjirckvuved-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=143.203}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite THZ
- common-name:
- 5-(2-hydroxyethyl)-4-methylthiazole
- smiles:
- cc1(n=csc(cco)=1)
- inchi-key:
- bkawjirckvuved-uhfffaoysa-n
- molecular-weight:
- 143.203