Difference between revisions of "Charged-CYS-tRNAs"

Revision as of 11:12, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17624 ==
+== Metabolite Amino-Acids-20 ==
 * common-name:
-** &omega;-carboxy-(9z)-octadec-9-enoyl-coa
+** a proteinogenic amino acid
-* smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** iiswkvfhqlaomw-btfuzuoasa-i
-* molecular-weight:
-** 1056.928
 == Reaction(s) known to consume the compound ==
+* [[L-AMINO-ACID-OXIDASE-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[RXN-6601]]
+* [[RXN66-336]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16418]]
+* [[3.4.11.1-RXN]]
+* [[3.4.11.4-RXN]]
+* [[3.4.13.18-RXN]]
+* [[3.4.13.9-RXN]]
+* [[3.4.16.2-RXN]]
+* [[3.4.17.19-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[RXN0-5204]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=&omega;-carboxy-(9z)-octadec-9-enoyl-coa}}
+{{#set: common-name=a proteinogenic amino acid}}
-{{#set: inchi-key=inchikey=iiswkvfhqlaomw-btfuzuoasa-i}}
-{{#set: molecular-weight=1056.928}}