Difference between revisions of "CPD-9460"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...")
(Created page with "Category:metabolite == Metabolite L-PHOSPHATIDATE == * common-name: ** a 1,2-diacyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * CDPDIGLYSYN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-7-DIMETHYLXANTHINE ==
+
== Metabolite L-PHOSPHATIDATE ==
 
* common-name:
 
* common-name:
** theobromine
+
** a 1,2-diacyl-sn-glycerol 3-phosphate
* smiles:
 
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 
* inchi-key:
 
** yapqbxqyljrxsa-uhfffaoysa-n
 
* molecular-weight:
 
** 180.166
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11519]]
+
* [[CDPDIGLYSYN-RXN]]
 +
* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
 +
* [[RXN-16066]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
* [[PHOSCHOL-RXN]]
 +
* [[RXN-11277]]
 +
* [[RXN-12116]]
 +
* [[RXN-12959]]
 +
* [[RXN-16066]]
 +
* [[RXN-1623]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=theobromine}}
+
{{#set: common-name=a 1,2-diacyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}
 
{{#set: molecular-weight=180.166}}
 

Revision as of 11:13, 15 January 2021

Metabolite L-PHOSPHATIDATE

  • common-name:
    • a 1,2-diacyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality