Difference between revisions of "CPD-8974"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...") |
(Created page with "Category:metabolite == Metabolite GLUCOSYL-GLYCOGENIN == * common-name: ** an α-d-glucosyl-[glycogenin] == Reaction(s) known to consume the compound == * [[RXN-7667]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLUCOSYL-GLYCOGENIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** an α-d-glucosyl-[glycogenin] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7667]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an α-d-glucosyl-[glycogenin]}} |
| − | |||
| − | |||
Revision as of 11:13, 15 January 2021
Contents
Metabolite GLUCOSYL-GLYCOGENIN
- common-name:
- an α-d-glucosyl-[glycogenin]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an α-d-glucosyl-[glycogenin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
