Difference between revisions of "CPD-6082"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11855 == * common-name: ** (r)-4-hydroxy-4-methyl-2-oxoglutarate * smiles: ** cc(o)(cc(c(=o)[o-])=o)c([o-])=o * inchi-key: ** yrwamsx...") |
(Created page with "Category:metabolite == Metabolite Receptor-proteins == * common-name: ** a receptor protein == Reaction(s) known to consume the compound == * 2.7.11.30-RXN == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Receptor-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a receptor protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.7.11.30-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.11.30-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a receptor protein}} |
| − | |||
| − | |||
Revision as of 11:13, 15 January 2021
Contents
Metabolite Receptor-proteins
- common-name:
- a receptor protein
