Difference between revisions of "Guanosine-34-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([o-])=o * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == |
* common-name: | * common-name: | ||
− | ** | + | ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.4.1.151-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r}} |
− | |||
− |
Revision as of 11:14, 15 January 2021
Contents
Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL
- common-name:
- an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r