Difference between revisions of "CPD-12019"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite tRNAs == * common-name: ** an uncharged trna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an uncharged trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[AMINOCYL-TRNA-HYDROLASE-RXN]] |
− | + | * [[RXN-15041]] | |
− | + | * [[RXN0-6480]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | * [[RXN0- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an uncharged trna}} |
− | |||
− |
Revision as of 11:14, 15 January 2021
Contents
Metabolite tRNAs
- common-name:
- an uncharged trna