Difference between revisions of "DIVINYLCHLOROPHYLLIDE-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Delta5-Delta7-Steroids == * common-name: ** a δ5,7-sterol == Reaction(s) known to consume the compound == * RXN-16378 == Reacti...")
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Delta5-Delta7-Steroids ==
+
== Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI ==
 
* common-name:
 
* common-name:
** a δ5,7-sterol
+
** leukotriene b4
 +
* smiles:
 +
** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
 +
* inchi-key:
 +
** vnyssyrcgwbhlg-amolwhmgsa-m
 +
* molecular-weight:
 +
** 335.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16378]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16378]]
+
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a δ5,7-sterol}}
+
{{#set: common-name=leukotriene b4}}
 +
{{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}}
 +
{{#set: molecular-weight=335.462}}

Revision as of 11:14, 15 January 2021

Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI

  • common-name:
    • leukotriene b4
  • smiles:
    • cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
  • inchi-key:
    • vnyssyrcgwbhlg-amolwhmgsa-m
  • molecular-weight:
    • 335.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality