Difference between revisions of "DIVINYLCHLOROPHYLLIDE-A"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Delta5-Delta7-Steroids == * common-name: ** a δ5,7-sterol == Reaction(s) known to consume the compound == * RXN-16378 == Reacti...") |
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == |
* common-name: | * common-name: | ||
− | ** | + | ** leukotriene b4 |
+ | * smiles: | ||
+ | ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** vnyssyrcgwbhlg-amolwhmgsa-m | ||
+ | * molecular-weight: | ||
+ | ** 335.462 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[LEUKOTRIENE-A4-HYDROLASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=leukotriene b4}} |
+ | {{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}} | ||
+ | {{#set: molecular-weight=335.462}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI
- common-name:
- leukotriene b4
- smiles:
- cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
- inchi-key:
- vnyssyrcgwbhlg-amolwhmgsa-m
- molecular-weight:
- 335.462