Difference between revisions of "Protein-GalNAc-GlcNAc-D-mannosyl-L-Thr"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13188 == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o...")
(Created page with "Category:metabolite == Metabolite S-1-PHENYLETHANOL == * common-name: ** (s)-1-phenylethanol * smiles: ** cc(o)c1(c=cc=cc=1) * inchi-key: ** wapnohkvxsqrpx-zetcqymhsa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13188 ==
+
== Metabolite S-1-PHENYLETHANOL ==
 
* common-name:
 
* common-name:
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
+
** (s)-1-phenylethanol
 
* smiles:
 
* smiles:
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
+
** cc(o)c1(c=cc=cc=1)
 
* inchi-key:
 
* inchi-key:
** cwvrqjbcbctflt-civpzrojsa-n
+
** wapnohkvxsqrpx-zetcqymhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 488.442
+
** 122.166
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12270]]
+
* [[RXN-1302]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
+
{{#set: common-name=(s)-1-phenylethanol}}
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
+
{{#set: inchi-key=inchikey=wapnohkvxsqrpx-zetcqymhsa-n}}
{{#set: molecular-weight=488.442}}
+
{{#set: molecular-weight=122.166}}

Revision as of 11:16, 15 January 2021

Metabolite S-1-PHENYLETHANOL

  • common-name:
    • (s)-1-phenylethanol
  • smiles:
    • cc(o)c1(c=cc=cc=1)
  • inchi-key:
    • wapnohkvxsqrpx-zetcqymhsa-n
  • molecular-weight:
    • 122.166

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality