Difference between revisions of "CPD-17281"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE == * common-name: ** gdp-l-fucose == Reaction(s) known to consume the compound == * RXN-15268 == Reactio...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** gdp-l-fucose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15268]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15268]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gdp-l-fucose}} |
| − | |||
| − | |||
Revision as of 11:16, 15 January 2021
Contents
Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE
- common-name:
- gdp-l-fucose
