Difference between revisions of "Phenols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...") |
(Created page with "Category:metabolite == Metabolite CPD-11606 == * common-name: ** stigmasterol 3-o-β-d-glucoside * smiles: ** ccc(c(c)c)c=cc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11606 == |
* common-name: | * common-name: | ||
| − | ** | + | ** stigmasterol 3-o-β-d-glucoside |
* smiles: | * smiles: | ||
| − | ** c( | + | ** ccc(c(c)c)c=cc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vwdloxmzigubkm-oytrldrlsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 574.84 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12126]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=stigmasterol 3-o-β-d-glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vwdloxmzigubkm-oytrldrlsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=574.84}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-11606
- common-name:
- stigmasterol 3-o-β-d-glucoside
- smiles:
- ccc(c(c)c)c=cc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
- inchi-key:
- vwdloxmzigubkm-oytrldrlsa-n
- molecular-weight:
- 574.84
