Difference between revisions of "THR"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...") |
(Created page with "Category:metabolite == Metabolite CPD-845 == * common-name: ** methyl chloride * smiles: ** ccl * inchi-key: ** nehmkbqyuwjmip-uhfffaoysa-n * molecular-weight: ** 50.488 =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-845 == |
* common-name: | * common-name: | ||
| − | ** | + | ** methyl chloride |
* smiles: | * smiles: | ||
| − | ** | + | ** ccl |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nehmkbqyuwjmip-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 50.488 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11267]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methyl chloride}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nehmkbqyuwjmip-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=50.488}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-845
- common-name:
- methyl chloride
- smiles:
- ccl
- inchi-key:
- nehmkbqyuwjmip-uhfffaoysa-n
- molecular-weight:
- 50.488
