Difference between revisions of "Basic-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(...")
(Created page with "Category:metabolite == Metabolite THR == * common-name: ** l-threonine * smiles: ** cc(o)c([n+])c(=o)[o-] * inchi-key: ** ayfvyjqapqtccc-gbxijsldsa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12575 ==
+
== Metabolite THR ==
 
* common-name:
 
* common-name:
** udp-α-d-glucose
+
** l-threonine
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** cc(o)c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hscjrczfdfqwrp-jzmiexbbsa-l
+
** ayfvyjqapqtccc-gbxijsldsa-n
 
* molecular-weight:
 
* molecular-weight:
** 564.289
+
** 119.12
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-14249]]
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [[RXN-14569]]
* [[2.4.1.117-RXN]]
+
* [[RXN-15122]]
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
* [[THREDEHYD-RXN]]
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[THREODEHYD-RXN]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[THREONINE--TRNA-LIGASE-RXN]]
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
+
* [[THREONINE-ALDOLASE-RXN]]
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
+
* [[biomass_rxn]]
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12126]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-1223]]
 
* [[RXN-15117]]
 
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-5482]]
 
* [[RXN-7667]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG4E]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-14569]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN-15122]]
* [[UDPGLUCEPIM-RXN]]
+
* [[RXN0-6980]]
* [[UDPGth]]
+
* [[THRESYN-RXN]]
* [[UG1PUT]]
 
* [[UG4E]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-glucose}}
+
{{#set: common-name=l-threonine}}
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
+
{{#set: inchi-key=inchikey=ayfvyjqapqtccc-gbxijsldsa-n}}
{{#set: molecular-weight=564.289}}
+
{{#set: molecular-weight=119.12}}

Revision as of 11:16, 15 January 2021

Metabolite THR

  • common-name:
    • l-threonine
  • smiles:
    • cc(o)c([n+])c(=o)[o-]
  • inchi-key:
    • ayfvyjqapqtccc-gbxijsldsa-n
  • molecular-weight:
    • 119.12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality