Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13227 == * common-name: ** n,n',n''-triacetylchitotriose * smiles: ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(...")
(Created page with "Category:metabolite == Metabolite METHYLBUT-CPD == * common-name: ** 2-methylbutanal * smiles: ** ccc(c)[ch]=o * inchi-key: ** bygqbdhughbgmd-uhfffaoysa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13227 ==
+
== Metabolite METHYLBUT-CPD ==
 
* common-name:
 
* common-name:
** n,n',n''-triacetylchitotriose
+
** 2-methylbutanal
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
+
** ccc(c)[ch]=o
 
* inchi-key:
 
* inchi-key:
** wzzvuhwlnmnwlw-mewklcdlsa-n
+
** bygqbdhughbgmd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 627.598
+
** 86.133
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7694]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12623]]
 
* [[RXN-12624]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n,n',n''-triacetylchitotriose}}
+
{{#set: common-name=2-methylbutanal}}
{{#set: inchi-key=inchikey=wzzvuhwlnmnwlw-mewklcdlsa-n}}
+
{{#set: inchi-key=inchikey=bygqbdhughbgmd-uhfffaoysa-n}}
{{#set: molecular-weight=627.598}}
+
{{#set: molecular-weight=86.133}}

Revision as of 11:16, 15 January 2021

Metabolite METHYLBUT-CPD

  • common-name:
    • 2-methylbutanal
  • smiles:
    • ccc(c)[ch]=o
  • inchi-key:
    • bygqbdhughbgmd-uhfffaoysa-n
  • molecular-weight:
    • 86.133

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality