Difference between revisions of "CPD-14736"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
(Created page with "Category:metabolite == Metabolite Purine-Ribonucleosides == * common-name: ** a purine ribonucleoside == Reaction(s) known to consume the compound == * PNP-RXN * PUR...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE ==
+
== Metabolite Purine-Ribonucleosides ==
 
* common-name:
 
* common-name:
** thiamine
+
** a purine ribonucleoside
* smiles:
 
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
** jzrwcgzrtzmzeh-uhfffaoysa-n
 
* molecular-weight:
 
** 265.352
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[PNP-RXN]]
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
+
* [[PURINE-NUCLEOSIDASE-RXN]]
* [[THIAMINASE-RXN]]
+
* [[RXN-7001]]
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[PNP-RXN]]
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine}}
+
{{#set: common-name=a purine ribonucleoside}}
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
 
{{#set: molecular-weight=265.352}}
 

Revision as of 11:16, 15 January 2021

Metabolite Purine-Ribonucleosides

  • common-name:
    • a purine ribonucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality