Difference between revisions of "Saturated-Fatty-Acyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytosine-38-in-tRNAs == * common-name: ** a cytosine38 in trna == Reaction(s) known to consume the compound == * RXN-11855 == Reactio...") |
(Created page with "Category:metabolite == Metabolite CPD-15839 == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c * inchi-key: ** o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15839 == |
* common-name: | * common-name: | ||
| − | ** | + | ** δ-tocotrienol |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c | ||
| + | * inchi-key: | ||
| + | ** odadklylwwchnb-ldybvbfysa-n | ||
| + | * molecular-weight: | ||
| + | ** 396.612 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14919]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=δ-tocotrienol}} |
| + | {{#set: inchi-key=inchikey=odadklylwwchnb-ldybvbfysa-n}} | ||
| + | {{#set: molecular-weight=396.612}} | ||
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-15839
- common-name:
- δ-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c
- inchi-key:
- odadklylwwchnb-ldybvbfysa-n
- molecular-weight:
- 396.612
