Difference between revisions of "CPD0-1422"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * inchi-key: ** qyojs...") |
(Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-452 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2. | + | * [[2.4.1.198-RXN]] |
| − | * [[ | + | * [[3.1.1.69-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2. | + | * [[2.4.1.198-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-452
- common-name:
- a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol
