Difference between revisions of "CPD-15189"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-Glutamyl-Peptides == * common-name: ** an n-terminal l-glutamyl-[protein] == Reaction(s) known to consume the compound == * RXN-17888...") |
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-725 == |
* common-name: | * common-name: | ||
− | ** | + | ** 13(s)-hpote |
+ | * smiles: | ||
+ | ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo | ||
+ | * inchi-key: | ||
+ | ** uyqgvdxdxbaabn-fqsphkrjsa-m | ||
+ | * molecular-weight: | ||
+ | ** 309.425 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1F-19]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-1321]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=13(s)-hpote}} |
+ | {{#set: inchi-key=inchikey=uyqgvdxdxbaabn-fqsphkrjsa-m}} | ||
+ | {{#set: molecular-weight=309.425}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-725
- common-name:
- 13(s)-hpote
- smiles:
- ccc=ccc(c=cc=ccccccccc([o-])=o)oo
- inchi-key:
- uyqgvdxdxbaabn-fqsphkrjsa-m
- molecular-weight:
- 309.425