Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...")
(Created page with "Category:metabolite == Metabolite CPD-13700 == * common-name: ** 3-oxo-4-pregnene-20-carboxyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SQUALENE ==
+
== Metabolite CPD-13700 ==
 
* common-name:
 
* common-name:
** squalene
+
** 3-oxo-4-pregnene-20-carboxyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
 
* inchi-key:
 
* inchi-key:
** yygntywphwgjrm-aajylucbsa-n
+
** cjjbducnumwujx-zktjokcmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 410.725
+
** 1089.98
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SMO]]
 
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13162]]
+
* [[RXN-12710]]
* [[RXN-13724]]
 
* [[RXN66-281]]
 
* [[SMO]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=squalene}}
+
{{#set: common-name=3-oxo-4-pregnene-20-carboxyl-coa}}
{{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}}
+
{{#set: inchi-key=inchikey=cjjbducnumwujx-zktjokcmsa-j}}
{{#set: molecular-weight=410.725}}
+
{{#set: molecular-weight=1089.98}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-13700

  • common-name:
    • 3-oxo-4-pregnene-20-carboxyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
  • inchi-key:
    • cjjbducnumwujx-zktjokcmsa-j
  • molecular-weight:
    • 1089.98

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality