Difference between revisions of "CPD0-1027"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-key: ** s...") |
(Created page with "Category:metabolite == Metabolite RIBITOL == * common-name: ** d-ribitol * smiles: ** c(o)c(o)c(o)c(o)co * inchi-key: ** hebkchpvoiaqta-zxfhetkhsa-n * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ribitol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c(o)c(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hebkchpvoiaqta-zxfhetkhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 152.147 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hebkchpvoiaqta-zxfhetkhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=152.147}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite RIBITOL
- common-name:
- d-ribitol
- smiles:
- c(o)c(o)c(o)c(o)co
- inchi-key:
- hebkchpvoiaqta-zxfhetkhsa-n
- molecular-weight:
- 152.147
