Difference between revisions of "CDP-ETHANOLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13611 == * common-name: ** sphinganine (c20) * smiles: ** cccccccccccccccccc(o)c([n+])co * inchi-key: ** ufmhybvqzspwss-vqtjnvassa-o...") |
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13390 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-methionyl-l-alanine dipeptide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jhkxzylnvjraaj-wdskdsinsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.286 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6985]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-methionyl-l-alanine dipeptide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.286}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite CPD-13390
- common-name:
- l-methionyl-l-alanine dipeptide
- smiles:
- cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
- inchi-key:
- jhkxzylnvjraaj-wdskdsinsa-n
- molecular-weight:
- 220.286
