Difference between revisions of "M7G5-pppR-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17282 == * common-name: ** a [glycerolipid]-icosapentaenoate == Reaction(s) known to consume the compound == * RXN-16139 * RXN-...")
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17282 ==
+
== Metabolite OXALO-SUCCINATE ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-icosapentaenoate
+
** oxalosuccinate
 +
* smiles:
 +
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
 +
* inchi-key:
 +
** ufscuaxltrfidc-uhfffaoysa-k
 +
* molecular-weight:
 +
** 187.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16139]]
+
* [[RXN-8642]]
* [[RXN-17688]]
+
* [[RXN-9951]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12755]]
+
* [[RXN-8642]]
* [[RXN-17688]]
+
* [[RXN-9951]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-icosapentaenoate}}
+
{{#set: common-name=oxalosuccinate}}
 +
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
 +
{{#set: molecular-weight=187.085}}

Revision as of 11:18, 15 January 2021

Metabolite OXALO-SUCCINATE

  • common-name:
    • oxalosuccinate
  • smiles:
    • c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
  • inchi-key:
    • ufscuaxltrfidc-uhfffaoysa-k
  • molecular-weight:
    • 187.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality