Difference between revisions of "BCAA-dehydrogenase-DH-lipoyl"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...") |
(Created page with "Category:metabolite == Metabolite CPD-12303 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine * smiles: ** cc(c)=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12303 == |
* common-name: | * common-name: | ||
− | ** | + | ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kcrofjgxxschga-ygmfixcysa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1598.955 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11347]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kcrofjgxxschga-ygmfixcysa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1598.955}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-12303
- common-name:
- undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
- inchi-key:
- kcrofjgxxschga-ygmfixcysa-k
- molecular-weight:
- 1598.955