Difference between revisions of "N4-N-ACETYL-BETA-D-GLUCOSAMINYL-F6"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14756 == * common-name: ** methylthiobenzoate * smiles: ** csc(c1(c=cc=cc=1))=o * inchi-key: ** rqvwtmcuthkgcm-uhfffaoysa-n * molecul...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14756 ==
+
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
 
* common-name:
 
* common-name:
** methylthiobenzoate
+
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** csc(c1(c=cc=cc=1))=o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** rqvwtmcuthkgcm-uhfffaoysa-n
+
** hdsgdgslnmimku-kfsstaeesa-n
 
* molecular-weight:
 
* molecular-weight:
** 152.211
+
** 699.111
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13725]]
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylthiobenzoate}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=rqvwtmcuthkgcm-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
{{#set: molecular-weight=152.211}}
+
{{#set: molecular-weight=699.111}}

Revision as of 11:19, 15 January 2021

Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • hdsgdgslnmimku-kfsstaeesa-n
  • molecular-weight:
    • 699.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality