Difference between revisions of "16S-rRNA-guanine1516"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-methionine == * common-name: ** a [protein]-l-methionine == Reaction(s) known to consume the compound == * 1.8.4.12-RXN ==...")
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-L-methionine ==
+
== Metabolite FMN ==
 
* common-name:
 
* common-name:
** a [protein]-l-methionine
+
** fmn
 +
* smiles:
 +
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
 +
* inchi-key:
 +
** ankzybdxhmzbdk-scrdcrapsa-k
 +
* molecular-weight:
 +
** 453.324
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.12-RXN]]
+
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[FADSYN-RXN]]
 +
* [[RXN-9510]]
 +
* [[RXN0-5187]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.8.4.12-RXN]]
+
* [[ARPT]]
* [[RXN-8668]]
+
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[RXN-9510]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-methionine}}
+
{{#set: common-name=fmn}}
 +
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
 +
{{#set: molecular-weight=453.324}}

Revision as of 11:19, 15 January 2021

Metabolite FMN

  • common-name:
    • fmn
  • smiles:
    • cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
  • inchi-key:
    • ankzybdxhmzbdk-scrdcrapsa-k
  • molecular-weight:
    • 453.324

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality