Difference between revisions of "CPD-17046"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ == * common-name: ** 5-(2-hydroxyethyl)-4-methylthiazole * smiles: ** cc1(n=csc(cco)=1) * inchi-key: ** bkawjirckvuved-uhfffaoysa-n *...") |
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DETHIOBIOTIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** dethiobiotin |
* smiles: | * smiles: | ||
| − | ** cc1( | + | ** cc1(nc(=o)nc1cccccc(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** autolbmxddtrrt-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 213.256 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| + | * [[RXN-17472]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DETHIOBIOTIN-SYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dethiobiotin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=213.256}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite DETHIOBIOTIN
- common-name:
- dethiobiotin
- smiles:
- cc1(nc(=o)nc1cccccc(=o)[o-])
- inchi-key:
- autolbmxddtrrt-uhfffaoysa-m
- molecular-weight:
- 213.256
