Difference between revisions of "LysW-L-glutamate-5-phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Farnesylated-CAAX-proteins == * common-name: ** a farnesylated protein that ends with a caax sequence == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-MANNOSE == * common-name: ** dtdp-4-dehydro-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Farnesylated-CAAX-proteins ==
+
== Metabolite DTDP-DEOH-DEOXY-MANNOSE ==
 
* common-name:
 
* common-name:
** a farnesylated protein that ends with a caax sequence
+
** dtdp-4-dehydro-β-l-rhamnose
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 +
* inchi-key:
 +
** psxwnitxwwecny-lpvgzgshsa-l
 +
* molecular-weight:
 +
** 544.302
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11698]]
+
* [[DTDPDEHYRHAMREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17573]]
+
* [[DTDPDEHYDRHAMEPIM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a farnesylated protein that ends with a caax sequence}}
+
{{#set: common-name=dtdp-4-dehydro-β-l-rhamnose}}
 +
{{#set: inchi-key=inchikey=psxwnitxwwecny-lpvgzgshsa-l}}
 +
{{#set: molecular-weight=544.302}}

Revision as of 08:24, 15 March 2021

Metabolite DTDP-DEOH-DEOXY-MANNOSE

  • common-name:
    • dtdp-4-dehydro-β-l-rhamnose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
  • inchi-key:
    • psxwnitxwwecny-lpvgzgshsa-l
  • molecular-weight:
    • 544.302

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality