Difference between revisions of "1-7-DIMETHYLXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine-sulfonate == * common-name: ** an n-terminal 3-sulfo-l-alanyl-[protein] == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite QUEUINE == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) * inchi-key: ** wyrolenthwjflr-acldm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite QUEUINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** queuine |
| + | * smiles: | ||
| + | ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) | ||
| + | * inchi-key: | ||
| + | ** wyrolenthwjflr-acldmzeesa-o | ||
| + | * molecular-weight: | ||
| + | ** 278.29 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=queuine}} |
| + | {{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}} | ||
| + | {{#set: molecular-weight=278.29}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite QUEUINE
- common-name:
- queuine
- smiles:
- c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
- inchi-key:
- wyrolenthwjflr-acldmzeesa-o
- molecular-weight:
- 278.29
