Difference between revisions of "CPD-14152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-PRENYLPHLORISOBUTYROPHENONE == * common-name: ** 4-prenylphlorisobutyrophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c...")
(Created page with "Category:metabolite == Metabolite CPD0-2353 == * common-name: ** a trna precursor with a short 3' extension == Reaction(s) known to consume the compound == == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-PRENYLPHLORISOBUTYROPHENONE ==
+
== Metabolite CPD0-2353 ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisobutyrophenone
+
** a trna precursor with a short 3' extension
* smiles:
 
** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c
 
* inchi-key:
 
** iobxamcsycvnet-uhfffaoysa-m
 
* molecular-weight:
 
** 263.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7813]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.1.26.5-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-prenylphlorisobutyrophenone}}
+
{{#set: common-name=a trna precursor with a short 3' extension}}
{{#set: inchi-key=inchikey=iobxamcsycvnet-uhfffaoysa-m}}
 
{{#set: molecular-weight=263.313}}
 

Revision as of 08:24, 15 March 2021

Metabolite CPD0-2353

  • common-name:
    • a trna precursor with a short 3' extension

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality