Difference between revisions of "CPD-7088"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALA-GLY == * common-name: ** l-alanyl-glycine * smiles: ** cc([n+])c(ncc([o-])=o)=o * inchi-key: ** cxispyvymqwfle-vkhmyheasa-n * molecul...")
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALA-GLY ==
+
== Metabolite SIROHYDROCHLORIN ==
 
* common-name:
 
* common-name:
** l-alanyl-glycine
+
** sirohydrochlorin
 
* smiles:
 
* smiles:
** cc([n+])c(ncc([o-])=o)=o
+
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
 
* inchi-key:
 
* inchi-key:
** cxispyvymqwfle-vkhmyheasa-n
+
** kwizrxmmfrbuml-ahgfgahvsa-f
 
* molecular-weight:
 
* molecular-weight:
** 146.146
+
** 854.779
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6977]]
+
* [[4.99.1.3-RXN]]
 +
* [[SIROHEME-FERROCHELAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DIMETHUROPORDEHYDROG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-glycine}}
+
{{#set: common-name=sirohydrochlorin}}
{{#set: inchi-key=inchikey=cxispyvymqwfle-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
{{#set: molecular-weight=146.146}}
+
{{#set: molecular-weight=854.779}}

Revision as of 08:24, 15 March 2021

Metabolite SIROHYDROCHLORIN

  • common-name:
    • sirohydrochlorin
  • smiles:
    • cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
  • inchi-key:
    • kwizrxmmfrbuml-ahgfgahvsa-f
  • molecular-weight:
    • 854.779

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality