Difference between revisions of "GLYCYLGLYCINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BENZENE-NO2 == * common-name: ** nitrobenzene * smiles: ** c1(=cc=c(c=c1)[n+]([o-])=o) * inchi-key: ** lqnuzadurlcdlv-uhfffaoysa-n * mole...") |
(Created page with "Category:metabolite == Metabolite Cytidine-34-tRNAs == * common-name: ** a cytidine34 in trna == Reaction(s) known to consume the compound == * RXN-11860 == Reaction(s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cytidine-34-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cytidine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11860]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cytidine34 in trna}} |
| − | |||
| − | |||
Revision as of 08:25, 15 March 2021
Contents
Metabolite Cytidine-34-tRNAs
- common-name:
- a cytidine34 in trna
