Difference between revisions of "EPISTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...") |
(Created page with "Category:metabolite == Metabolite Xenobiotic == * common-name: ** a xenobiotic == Reaction(s) known to consume the compound == * 3.6.3.44-RXN == Reaction(s) known to p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Xenobiotic == |
* common-name: | * common-name: | ||
| − | ** | + | ** a xenobiotic |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.6.3.44-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.6.3.44-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a xenobiotic}} |
| − | |||
| − | |||
Revision as of 08:25, 15 March 2021
Contents
Metabolite Xenobiotic
- common-name:
- a xenobiotic
