Difference between revisions of "CPD-11497"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14394 == * common-name: ** (8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o...")
(Created page with "Category:metabolite == Metabolite Protein-tyrosine-phosphates == * common-name: ** a [protein]-l-tyrosine phosphate == Reaction(s) known to consume the compound == * PRO...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14394 ==
+
== Metabolite Protein-tyrosine-phosphates ==
 
* common-name:
 
* common-name:
** (8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa
+
** a [protein]-l-tyrosine phosphate
* smiles:
 
** ccc=ccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** plhicykopitjjt-qwoxclfssa-j
 
* molecular-weight:
 
** 1049.959
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16042]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.10.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa}}
+
{{#set: common-name=a [protein]-l-tyrosine phosphate}}
{{#set: inchi-key=inchikey=plhicykopitjjt-qwoxclfssa-j}}
 
{{#set: molecular-weight=1049.959}}
 

Revision as of 08:25, 15 March 2021

Metabolite Protein-tyrosine-phosphates

  • common-name:
    • a [protein]-l-tyrosine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.