Difference between revisions of "CPD-15662"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == * common-name: ** 3-(all-trans-octaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14928 ==
+
== Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL ==
 
* common-name:
 
* common-name:
** phytenoyl-coa
+
** 3-(all-trans-octaprenyl)benzene-1,2-diol
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** nyzpdfuazacyot-peaqseffsa-j
+
** ynpgymzvnlizld-bqfktqoqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1056.006
+
** 655.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-482]]
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-480]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytenoyl-coa}}
+
{{#set: common-name=3-(all-trans-octaprenyl)benzene-1,2-diol}}
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
+
{{#set: inchi-key=inchikey=ynpgymzvnlizld-bqfktqoqsa-n}}
{{#set: molecular-weight=1056.006}}
+
{{#set: molecular-weight=655.058}}

Revision as of 08:26, 15 March 2021

Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL

  • common-name:
    • 3-(all-trans-octaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • ynpgymzvnlizld-bqfktqoqsa-n
  • molecular-weight:
    • 655.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality