Difference between revisions of "CPD-9451"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18437 == * common-name: ** 3-hydroxy-4-methyl-anthranilate pentapeptide lactone * smiles: ** cc(c)c1(c(=o)n3([ch](c(n(c)cc(n(c(c(c)c)...")
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18437 ==
+
== Metabolite CPD-170 ==
 
* common-name:
 
* common-name:
** 3-hydroxy-4-methyl-anthranilate pentapeptide lactone
+
** stachyose
 
* smiles:
 
* smiles:
** cc(c)c1(c(=o)n3([ch](c(n(c)cc(n(c(c(c)c)c(=o)oc(c)c(c(n1)=o)nc(=o)c2(c=cc(c)=c(c(n)=2)o))c)=o)=o)ccc3))
+
** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
 
* inchi-key:
 
* inchi-key:
** idanitfecicajb-mpkzyahhsa-n
+
** uqziybxshagnoe-xnsrjbnmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 630.74
+
** 666.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17067]]
+
* [[2.4.1.67-RXN]]
 +
* [[RXN-11501]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.67-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-4-methyl-anthranilate pentapeptide lactone}}
+
{{#set: common-name=stachyose}}
{{#set: inchi-key=inchikey=idanitfecicajb-mpkzyahhsa-n}}
+
{{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}}
{{#set: molecular-weight=630.74}}
+
{{#set: molecular-weight=666.583}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-170

  • common-name:
    • stachyose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
  • inchi-key:
    • uqziybxshagnoe-xnsrjbnmsa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality