Difference between revisions of "4-IMIDAZOLEACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15654 == * common-name: ** 2-trans, 4-cis-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15654 ==
+
== Metabolite LINOLENOYL-COA ==
 
* common-name:
 
* common-name:
** 2-trans, 4-cis-undecadienoyl-coa
+
** α-linolenoyl-coa
 
* smiles:
 
* smiles:
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
 
* inchi-key:
 
* inchi-key:
** szkpluulggerfd-nfpsboapsa-j
+
** omkfkbgzhnjnex-kzwmewpfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 927.749
+
** 1023.921
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14776]]
+
* [[RXN-13426]]
 +
* [[RXN-13441]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14775]]
+
* [[LINOLENOYL-RXN]]
 +
* [[LNLNCACOAL]]
 +
* [[llcoas]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 4-cis-undecadienoyl-coa}}
+
{{#set: common-name=α-linolenoyl-coa}}
{{#set: inchi-key=inchikey=szkpluulggerfd-nfpsboapsa-j}}
+
{{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}}
{{#set: molecular-weight=927.749}}
+
{{#set: molecular-weight=1023.921}}

Revision as of 08:27, 15 March 2021

Metabolite LINOLENOYL-COA

  • common-name:
    • α-linolenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
  • inchi-key:
    • omkfkbgzhnjnex-kzwmewpfsa-j
  • molecular-weight:
    • 1023.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality