Difference between revisions of "PROTEIN-LIPOYLLYSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-2-hydroxyacids == * common-name: ** an (r)-2-hydroxycarboxylate == Reaction(s) known to consume the compound == * 1.1.1.272-RXN ==...") |
(Created page with "Category:metabolite == Metabolite CPD-804 == * common-name: ** (4s)-4-hydroxy-2-oxoheptanedioate * smiles: ** c(ccc(o)cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hnoajoyerzts...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-804 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (4s)-4-hydroxy-2-oxoheptanedioate |
| + | * smiles: | ||
| + | ** c(ccc(o)cc(c([o-])=o)=o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** hnoajoyerztsnk-bypyzucnsa-l | ||
| + | * molecular-weight: | ||
| + | ** 188.137 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(4s)-4-hydroxy-2-oxoheptanedioate}} |
| + | {{#set: inchi-key=inchikey=hnoajoyerztsnk-bypyzucnsa-l}} | ||
| + | {{#set: molecular-weight=188.137}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-804
- common-name:
- (4s)-4-hydroxy-2-oxoheptanedioate
- smiles:
- c(ccc(o)cc(c([o-])=o)=o)([o-])=o
- inchi-key:
- hnoajoyerztsnk-bypyzucnsa-l
- molecular-weight:
- 188.137
