Difference between revisions of "CPD0-1422"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * smiles: ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-METHYL-ACETO-ACETYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methylacetoacetyl-coa |
+ | * smiles: | ||
+ | ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c | ||
+ | * inchi-key: | ||
+ | ** nhnodhrscralbf-nqnbqjknsa-j | ||
+ | * molecular-weight: | ||
+ | ** 861.604 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.1.1.178-RXN]] |
− | * [[ | + | * [[ACCAT]] |
+ | * [[HMNOS]] | ||
+ | * [[METHYLACETOACETYLCOATHIOL-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.1.1.178-RXN]] |
+ | * [[HMNOS]] | ||
+ | * [[METHYLACETOACETYLCOATHIOL-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methylacetoacetyl-coa}} |
+ | {{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}} | ||
+ | {{#set: molecular-weight=861.604}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite 2-METHYL-ACETO-ACETYL-COA
- common-name:
- 2-methylacetoacetyl-coa
- smiles:
- cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
- inchi-key:
- nhnodhrscralbf-nqnbqjknsa-j
- molecular-weight:
- 861.604