Difference between revisions of "CPD0-1422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * smiles: ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-452 ==
+
== Metabolite 2-METHYL-ACETO-ACETYL-COA ==
 
* common-name:
 
* common-name:
** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol
+
** 2-methylacetoacetyl-coa
 +
* smiles:
 +
** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
 +
* inchi-key:
 +
** nhnodhrscralbf-nqnbqjknsa-j
 +
* molecular-weight:
 +
** 861.604
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.198-RXN]]
+
* [[1.1.1.178-RXN]]
* [[3.1.1.69-RXN]]
+
* [[ACCAT]]
 +
* [[HMNOS]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.198-RXN]]
+
* [[1.1.1.178-RXN]]
 +
* [[HMNOS]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol}}
+
{{#set: common-name=2-methylacetoacetyl-coa}}
 +
{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}
 +
{{#set: molecular-weight=861.604}}

Revision as of 08:28, 15 March 2021

Metabolite 2-METHYL-ACETO-ACETYL-COA

  • common-name:
    • 2-methylacetoacetyl-coa
  • smiles:
    • cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
  • inchi-key:
    • nhnodhrscralbf-nqnbqjknsa-j
  • molecular-weight:
    • 861.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality