Difference between revisions of "DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * smiles: ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...")
(Created page with "Category:metabolite == Metabolite L-seryl-SEC-tRNAs == * common-name: ** an l-seryl-[trnasec] == Reaction(s) known to consume the compound == * RXN-10038 == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-ACETO-ACETYL-COA ==
+
== Metabolite L-seryl-SEC-tRNAs ==
 
* common-name:
 
* common-name:
** 2-methylacetoacetyl-coa
+
** an l-seryl-[trnasec]
* smiles:
 
** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
 
* inchi-key:
 
** nhnodhrscralbf-nqnbqjknsa-j
 
* molecular-weight:
 
** 861.604
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.178-RXN]]
+
* [[RXN-10038]]
* [[ACCAT]]
 
* [[HMNOS]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.178-RXN]]
+
* [[RXN-10038]]
* [[HMNOS]]
+
* [[RXN0-2161]]
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylacetoacetyl-coa}}
+
{{#set: common-name=an l-seryl-[trnasec]}}
{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}
 
{{#set: molecular-weight=861.604}}
 

Revision as of 08:29, 15 March 2021

Metabolite L-seryl-SEC-tRNAs

  • common-name:
    • an l-seryl-[trnasec]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-seryl-[trnasec" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.