Difference between revisions of "Very-Long-Chain-Trans-23-Dehydroacyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite Nucleoside-Diphosphates == * common-name: ** a nucleoside diphosphate == Reaction(s) known to consume the compound == * 2.7.4.10-RXN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Nucleoside-Diphosphates == |
* common-name: | * common-name: | ||
− | ** | + | ** a nucleoside diphosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.4.10-RXN]] | ||
+ | * [[2.7.7.8-RXN]] | ||
+ | * [[NUCLEOSIDE-DIP-KIN-RXN]] | ||
+ | * [[NUCLEOSIDE-DIPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.4.10-RXN]] |
− | * [[RXN- | + | * [[2.7.7.8-RXN]] |
+ | * [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a nucleoside diphosphate}} |
− | |||
− |
Revision as of 08:29, 15 March 2021
Contents
Metabolite Nucleoside-Diphosphates
- common-name:
- a nucleoside diphosphate