Difference between revisions of "3-Methyl-Saturated-Fatty-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-METHYLXANTHINE == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) * inchi-key: ** pfwlfwpasulgan-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite VERY-LONG-CHAIN-FATTY-ACYL-COA == * common-name: ** a very long chain fatty acyl-coa == Reaction(s) known to consume the compound == * ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite VERY-LONG-CHAIN-FATTY-ACYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a very long chain fatty acyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3O-328]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16415]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a very long chain fatty acyl-coa}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite VERY-LONG-CHAIN-FATTY-ACYL-COA
- common-name:
- a very long chain fatty acyl-coa
