Difference between revisions of "Initiation-tRNAmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15567 == * common-name: ** (3e)-tetradec-3-enoyl-coa * smiles: ** ccccccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...") |
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13397 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-threonine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(c(o)c)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** buqichwnxbibog-lmvfsukvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 190.199 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6980]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-threonine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=190.199}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-13397
- common-name:
- l-alanyl-l-threonine
- smiles:
- cc([n+])c(=o)nc(c(o)c)c([o-])=o
- inchi-key:
- buqichwnxbibog-lmvfsukvsa-n
- molecular-weight:
- 190.199
