Difference between revisions of "CPD-15152"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...") |
(Created page with "Category:metabolite == Metabolite CPD-9958 == * common-name: ** ubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9958 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinol-10 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qntnkslofhefpk-uptccgcdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 865.373 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9237]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinol-10}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qntnkslofhefpk-uptccgcdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=865.373}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-9958
- common-name:
- ubiquinol-10
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- qntnkslofhefpk-uptccgcdsa-n
- molecular-weight:
- 865.373
