Difference between revisions of "CDP-ETHANOLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...") |
(Created page with "Category:metabolite == Metabolite Relaxed-DNAs == * common-name: ** a relaxed dna == Reaction(s) known to consume the compound == * 5.99.1.2-RXN == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Relaxed-DNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a relaxed dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[5.99.1.2-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[5.99.1.2-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a relaxed dna}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite Relaxed-DNAs
- common-name:
- a relaxed dna
