Difference between revisions of "Glycoprotein-L-serine-or-L-threonine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * inchi-key: ** ydgmgexadbmomj-lurj...") |
(Created page with "Category:metabolite == Metabolite 18S-rRNA-N1-methylpseudouridine-1191 == * common-name: ** an 18s rrna n1-methylpseudouridine1191 == Reaction(s) known to consume the comp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 18S-rRNA-N1-methylpseudouridine-1191 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an 18s rrna n1-methylpseudouridine1191 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13327]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an 18s rrna n1-methylpseudouridine1191}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite 18S-rRNA-N1-methylpseudouridine-1191
- common-name:
- an 18s rrna n1-methylpseudouridine1191
