Difference between revisions of "GLUTAMYL-GLX-TRNAS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-SUCCINYLBENZOATE == * common-name: ** 2-succinylbenzoate * smiles: ** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-]) * inchi-key: ** yivwqn...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-5-methyluracil1939 == * common-name: ** a 5-methyluracil1939 in 23s rrna == Reaction(s) known to consume the compound == == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-SUCCINYLBENZOATE ==
+
== Metabolite 23S-rRNA-5-methyluracil1939 ==
 
* common-name:
 
* common-name:
** 2-succinylbenzoate
+
** a 5-methyluracil1939 in 23s rrna
* smiles:
 
** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
 
* inchi-key:
 
** yivwqnvqrxfzjb-uhfffaoysa-l
 
* molecular-weight:
 
** 220.181
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 
* [[RXN-7614]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11601]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-succinylbenzoate}}
+
{{#set: common-name=a 5-methyluracil1939 in 23s rrna}}
{{#set: inchi-key=inchikey=yivwqnvqrxfzjb-uhfffaoysa-l}}
 
{{#set: molecular-weight=220.181}}
 

Revision as of 08:30, 15 March 2021

Metabolite 23S-rRNA-5-methyluracil1939

  • common-name:
    • a 5-methyluracil1939 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality