Difference between revisions of "CPD-7222"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SS-Oligoribonucleotides == * common-name: ** a single-stranded oligoribonucleotide == Reaction(s) known to consume the compound == == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SS-Oligoribonucleotides ==
+
== Metabolite CPD-16551 ==
 
* common-name:
 
* common-name:
** a single-stranded oligoribonucleotide
+
** β-d-ribose 5-phosphate
 +
* smiles:
 +
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
 +
* inchi-key:
 +
** ktvpxoyakdprhy-txicztdvsa-l
 +
* molecular-weight:
 +
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.11-RXN]]
+
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a single-stranded oligoribonucleotide}}
+
{{#set: common-name=β-d-ribose 5-phosphate}}
 +
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}}
 +
{{#set: molecular-weight=228.095}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-16551

  • common-name:
    • β-d-ribose 5-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
  • inchi-key:
    • ktvpxoyakdprhy-txicztdvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality