Difference between revisions of "NNN-trimethyl-terminal-XPK"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...") |
(Created page with "Category:metabolite == Metabolite yW-58 == * common-name: ** 7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Reaction(s) known to consume the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite yW-58 == |
* common-name: | * common-name: | ||
− | ** | + | ** 7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14520]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-14528]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe}} |
− | |||
− |
Revision as of 08:30, 15 March 2021
Contents
Metabolite yW-58
- common-name:
- 7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "7-[(3s)-4-methoxy-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.