Difference between revisions of "PYRIDOXINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
(Created page with "Category:metabolite == Metabolite Charged-GLN-tRNAs == * common-name: ** an l-glutaminyl-[trnagln] == Reaction(s) known to consume the compound == == Reaction(s) known to...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Charged-GLN-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-glutaminyl-[trnagln] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[6.3.5.7-RXN]] | ||
| + | * [[GLUTAMINE--TRNA-LIGASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-glutaminyl-[trnagln]}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite Charged-GLN-tRNAs
- common-name:
- an l-glutaminyl-[trnagln]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-glutaminyl-[trnagln" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
